C29H31N5O8 — CID 129250792
2-(1,3-dioxoisoindol-2-yl)oxy-3-[4-[6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]pyridazin-3-yl]phenoxy]propanoic acid (PubChem CID 129250792) has the molecular formula C29H31N5O8 and a molecular weight of 577.59 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)oxy-3-[4-[6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]pyridazin-3-yl]phenoxy]propanoic acid.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)oxy-3-[4-[6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]pyridazin-3-yl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 129250792 |
| Molecular Formula | C29H31N5O8 |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)oxy-3-[4-[6-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]pyridazin-3-yl]phenoxy]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCNc1ccc(-c2ccc(OCC(ON3C(=O)c4ccccc4C3=O)C(=O)O)cc2)nn1 |
| InChI | InChI=1S/C29H31N5O8/c1-29(2,3)41-28(39)31-16-6-15-30-24-14-13-22(32-33-24)18-9-11-19(12-10-18)40-17-23(27(37)38)42-34-25(35)20-7-4-5-8-21(20)26(34)36/h4-5,7-14,23H,6,15-17H2,1-3H3,(H,30,33)(H,31,39)(H,37,38) |
| InChIKey | GDLDUHIOXYATPJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 169.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|