C33H39N4O9+ — CID 129250933
tert-butyl 2-(1,3-dioxoisoindol-2-yl)oxy-3-[[6-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyridin-1-ium-4-yl]oxy-3-pyridinyl]oxy]propanoate (PubChem CID 129250933) has the molecular formula C33H39N4O9+ and a molecular weight of 635.69 g/mol. Its IUPAC name is tert-butyl 2-(1,3-dioxoisoindol-2-yl)oxy-3-[[6-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyridin-1-ium-4-yl]oxy-3-pyridinyl]oxy]propanoate.
| Compound Name | tert-butyl 2-(1,3-dioxoisoindol-2-yl)oxy-3-[[6-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyridin-1-ium-4-yl]oxy-3-pyridinyl]oxy]propanoate |
|---|---|
| PubChem CID | 129250933 |
| Molecular Formula | C33H39N4O9+ |
| Molecular Weight | 635.69 g/mol |
| Exact Mass | 635.27 |
| IUPAC Name | tert-butyl 2-(1,3-dioxoisoindol-2-yl)oxy-3-[[6-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyridin-1-ium-4-yl]oxy-3-pyridinyl]oxy]propanoate |
| SMILES | CC(C)(C)OC(=O)NCCC[n+]1ccc(Oc2ccc(OCC(ON3C(=O)c4ccccc4C3=O)C(=O)OC(C)(C)C)cn2)cc1 |
| InChI | InChI=1S/C33H38N4O9/c1-32(2,3)44-30(40)26(46-37-28(38)24-10-7-8-11-25(24)29(37)39)21-42-23-12-13-27(35-20-23)43-22-14-18-36(19-15-22)17-9-16-34-31(41)45-33(4,5)6/h7-8,10-15,18-20,26H,9,16-17,21H2,1-6H3/p+1 |
| InChIKey | ZHDGHWXSDDCCJQ-UHFFFAOYSA-O |
| XLogP | 4.39 |
| TPSA | 146.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.69 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|