C32H38N4O8 — CID 129250740
tert-butyl (2S)-2-(1,3-dioxoisoindol-2-yl)oxy-3-[4-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]phenoxy]propanoate (PubChem CID 129250740) has the molecular formula C32H38N4O8 and a molecular weight of 606.68 g/mol. Its IUPAC name is tert-butyl (2S)-2-(1,3-dioxoisoindol-2-yl)oxy-3-[4-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]phenoxy]propanoate.
| Compound Name | tert-butyl (2S)-2-(1,3-dioxoisoindol-2-yl)oxy-3-[4-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]phenoxy]propanoate |
|---|---|
| PubChem CID | 129250740 |
| Molecular Formula | C32H38N4O8 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | tert-butyl (2S)-2-(1,3-dioxoisoindol-2-yl)oxy-3-[4-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]phenoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)NCCCn1cc(-c2ccc(OC[C@H](ON3C(=O)c4ccccc4C3=O)C(=O)OC(C)(C)C)cc2)cn1 |
| InChI | InChI=1S/C32H38N4O8/c1-31(2,3)42-29(39)26(44-36-27(37)24-10-7-8-11-25(24)28(36)38)20-41-23-14-12-21(13-15-23)22-18-34-35(19-22)17-9-16-33-30(40)43-32(4,5)6/h7-8,10-15,18-19,26H,9,16-17,20H2,1-6H3,(H,33,40)/t26-/m0/s1 |
| InChIKey | UWXKTIFNMXEQPM-SANMLTNESA-N |
| XLogP | 4.78 |
| TPSA | 138.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|