C18H25ClN4O2 — CID 171916573
tert-butyl N-[3-[4-(4-amino-2-chloro-3-methylphenyl)pyrazol-1-yl]propyl]carbamate (PubChem CID 171916573) has the molecular formula C18H25ClN4O2 and a molecular weight of 364.88 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(4-amino-2-chloro-3-methylphenyl)pyrazol-1-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(4-amino-2-chloro-3-methylphenyl)pyrazol-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 171916573 |
| Molecular Formula | C18H25ClN4O2 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | tert-butyl N-[3-[4-(4-amino-2-chloro-3-methylphenyl)pyrazol-1-yl]propyl]carbamate |
| SMILES | Cc1c(N)ccc(-c2cnn(CCCNC(=O)OC(C)(C)C)c2)c1Cl |
| InChI | InChI=1S/C18H25ClN4O2/c1-12-15(20)7-6-14(16(12)19)13-10-22-23(11-13)9-5-8-21-17(24)25-18(2,3)4/h6-7,10-11H,5,8-9,20H2,1-4H3,(H,21,24) |
| InChIKey | JTCUJQFLMBJBDW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|