C17H23FN4O2 — CID 171906287
tert-butyl N-[2-[4-(4-amino-2-fluoro-3-methylphenyl)pyrazol-1-yl]ethyl]carbamate (PubChem CID 171906287) has the molecular formula C17H23FN4O2 and a molecular weight of 334.40 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(4-amino-2-fluoro-3-methylphenyl)pyrazol-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(4-amino-2-fluoro-3-methylphenyl)pyrazol-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 171906287 |
| Molecular Formula | C17H23FN4O2 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | tert-butyl N-[2-[4-(4-amino-2-fluoro-3-methylphenyl)pyrazol-1-yl]ethyl]carbamate |
| SMILES | Cc1c(N)ccc(-c2cnn(CCNC(=O)OC(C)(C)C)c2)c1F |
| InChI | InChI=1S/C17H23FN4O2/c1-11-14(19)6-5-13(15(11)18)12-9-21-22(10-12)8-7-20-16(23)24-17(2,3)4/h5-6,9-10H,7-8,19H2,1-4H3,(H,20,23) |
| InChIKey | KTBCFNRIGJUBEG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|