C18H19F3N4O2 — CID 170855209
tert-butyl N-[2-[4-[4-cyano-2-(trifluoromethyl)phenyl]pyrazol-1-yl]ethyl]carbamate (PubChem CID 170855209) has the molecular formula C18H19F3N4O2 and a molecular weight of 380.37 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[4-cyano-2-(trifluoromethyl)phenyl]pyrazol-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[4-cyano-2-(trifluoromethyl)phenyl]pyrazol-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 170855209 |
| Molecular Formula | C18H19F3N4O2 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | tert-butyl N-[2-[4-[4-cyano-2-(trifluoromethyl)phenyl]pyrazol-1-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCn1cc(-c2ccc(C#N)cc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C18H19F3N4O2/c1-17(2,3)27-16(26)23-6-7-25-11-13(10-24-25)14-5-4-12(9-22)8-15(14)18(19,20)21/h4-5,8,10-11H,6-7H2,1-3H3,(H,23,26) |
| InChIKey | XGNPKURBHCJXAB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |