C17H20F3N3O4 — CID 171115701
tert-butyl N-[2-[4-[2-hydroxy-5-(trifluoromethoxy)phenyl]pyrazol-1-yl]ethyl]carbamate (PubChem CID 171115701) has the molecular formula C17H20F3N3O4 and a molecular weight of 387.36 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[2-hydroxy-5-(trifluoromethoxy)phenyl]pyrazol-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[2-hydroxy-5-(trifluoromethoxy)phenyl]pyrazol-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 171115701 |
| Molecular Formula | C17H20F3N3O4 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | tert-butyl N-[2-[4-[2-hydroxy-5-(trifluoromethoxy)phenyl]pyrazol-1-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCn1cc(-c2cc(OC(F)(F)F)ccc2O)cn1 |
| InChI | InChI=1S/C17H20F3N3O4/c1-16(2,3)27-15(25)21-6-7-23-10-11(9-22-23)13-8-12(4-5-14(13)24)26-17(18,19)20/h4-5,8-10,24H,6-7H2,1-3H3,(H,21,25) |
| InChIKey | NFJHXRWGRGKGPH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |