C17H22F2N4O2 — CID 171394108
tert-butyl N-[2-[4-[3-amino-5-(difluoromethyl)phenyl]pyrazol-1-yl]ethyl]carbamate (PubChem CID 171394108) has the molecular formula C17H22F2N4O2 and a molecular weight of 352.39 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[3-amino-5-(difluoromethyl)phenyl]pyrazol-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[3-amino-5-(difluoromethyl)phenyl]pyrazol-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 171394108 |
| Molecular Formula | C17H22F2N4O2 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | tert-butyl N-[2-[4-[3-amino-5-(difluoromethyl)phenyl]pyrazol-1-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCn1cc(-c2cc(N)cc(C(F)F)c2)cn1 |
| InChI | InChI=1S/C17H22F2N4O2/c1-17(2,3)25-16(24)21-4-5-23-10-13(9-22-23)11-6-12(15(18)19)8-14(20)7-11/h6-10,15H,4-5,20H2,1-3H3,(H,21,24) |
| InChIKey | YVRDLOAOYAJDRJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|