C18H19F2N3O2 — CID 172909538
tert-butyl N-[2-[4-(2-ethynyl-4,5-difluorophenyl)pyrazol-1-yl]ethyl]carbamate (PubChem CID 172909538) has the molecular formula C18H19F2N3O2 and a molecular weight of 347.37 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(2-ethynyl-4,5-difluorophenyl)pyrazol-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(2-ethynyl-4,5-difluorophenyl)pyrazol-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 172909538 |
| Molecular Formula | C18H19F2N3O2 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | tert-butyl N-[2-[4-(2-ethynyl-4,5-difluorophenyl)pyrazol-1-yl]ethyl]carbamate |
| SMILES | C#Cc1cc(F)c(F)cc1-c1cnn(CCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H19F2N3O2/c1-5-12-8-15(19)16(20)9-14(12)13-10-22-23(11-13)7-6-21-17(24)25-18(2,3)4/h1,8-11H,6-7H2,2-4H3,(H,21,24) |
| InChIKey | KADIEHDBYAYZDH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|