C15H12F2N2 — CID 172909545
1-(cyclopropylmethyl)-4-(2-ethynyl-4,5-difluorophenyl)pyrazole (PubChem CID 172909545) has the molecular formula C15H12F2N2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4-(2-ethynyl-4,5-difluorophenyl)pyrazole.
| Compound Name | 1-(cyclopropylmethyl)-4-(2-ethynyl-4,5-difluorophenyl)pyrazole |
|---|---|
| PubChem CID | 172909545 |
| Molecular Formula | C15H12F2N2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-(cyclopropylmethyl)-4-(2-ethynyl-4,5-difluorophenyl)pyrazole |
| SMILES | C#Cc1cc(F)c(F)cc1-c1cnn(CC2CC2)c1 |
| InChI | InChI=1S/C15H12F2N2/c1-2-11-5-14(16)15(17)6-13(11)12-7-18-19(9-12)8-10-3-4-10/h1,5-7,9-10H,3-4,8H2 |
| InChIKey | CIHOFDJJGINWJM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|