C19H21FN4O2 — CID 172915325
tert-butyl 3-[[4-(5-cyano-2-fluorophenyl)pyrazol-1-yl]methyl]azetidine-1-carboxylate (PubChem CID 172915325) has the molecular formula C19H21FN4O2 and a molecular weight of 356.40 g/mol. Its IUPAC name is tert-butyl 3-[[4-(5-cyano-2-fluorophenyl)pyrazol-1-yl]methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-(5-cyano-2-fluorophenyl)pyrazol-1-yl]methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 172915325 |
| Molecular Formula | C19H21FN4O2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | tert-butyl 3-[[4-(5-cyano-2-fluorophenyl)pyrazol-1-yl]methyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Cn2cc(-c3cc(C#N)ccc3F)cn2)C1 |
| InChI | InChI=1S/C19H21FN4O2/c1-19(2,3)26-18(25)23-9-14(10-23)11-24-12-15(8-22-24)16-6-13(7-21)4-5-17(16)20/h4-6,8,12,14H,9-11H2,1-3H3 |
| InChIKey | YRSSXSFBGJVOPB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |