C22H28FN3O2 — CID 171919908
tert-butyl 4-[[4-(5-ethenyl-2-fluorophenyl)pyrazol-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 171919908) has the molecular formula C22H28FN3O2 and a molecular weight of 385.48 g/mol. Its IUPAC name is tert-butyl 4-[[4-(5-ethenyl-2-fluorophenyl)pyrazol-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(5-ethenyl-2-fluorophenyl)pyrazol-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171919908 |
| Molecular Formula | C22H28FN3O2 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | tert-butyl 4-[[4-(5-ethenyl-2-fluorophenyl)pyrazol-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | C=Cc1ccc(F)c(-c2cnn(CC3CCN(C(=O)OC(C)(C)C)CC3)c2)c1 |
| InChI | InChI=1S/C22H28FN3O2/c1-5-16-6-7-20(23)19(12-16)18-13-24-26(15-18)14-17-8-10-25(11-9-17)21(27)28-22(2,3)4/h5-7,12-13,15,17H,1,8-11,14H2,2-4H3 |
| InChIKey | PTHCXRGRYHSEIR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |