C19H27N5O2 — CID 166513769
tert-butyl 4-[[4-(2-amino-4-pyridinyl)pyrazol-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 166513769) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is tert-butyl 4-[[4-(2-amino-4-pyridinyl)pyrazol-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(2-amino-4-pyridinyl)pyrazol-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166513769 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | tert-butyl 4-[[4-(2-amino-4-pyridinyl)pyrazol-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cn2cc(-c3ccnc(N)c3)cn2)CC1 |
| InChI | InChI=1S/C19H27N5O2/c1-19(2,3)26-18(25)23-8-5-14(6-9-23)12-24-13-16(11-22-24)15-4-7-21-17(20)10-15/h4,7,10-11,13-14H,5-6,8-9,12H2,1-3H3,(H2,20,21) |
| InChIKey | BKQQALGGDOJIDL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |