C23H28N4O2 — CID 172677769
tert-butyl 4-[4-(6-aminonaphthalen-2-yl)pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 172677769) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is tert-butyl 4-[4-(6-aminonaphthalen-2-yl)pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(6-aminonaphthalen-2-yl)pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172677769 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | tert-butyl 4-[4-(6-aminonaphthalen-2-yl)pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(-c3ccc4cc(N)ccc4c3)cn2)CC1 |
| InChI | InChI=1S/C23H28N4O2/c1-23(2,3)29-22(28)26-10-8-21(9-11-26)27-15-19(14-25-27)17-4-5-18-13-20(24)7-6-16(18)12-17/h4-7,12-15,21H,8-11,24H2,1-3H3 |
| InChIKey | WHXFQXGPVBRTKX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|