C25H31N7O3 — CID 164524533
tert-butyl 4-[4-[6-amino-5-[(4-aminophenyl)carbamoyl]-3-pyridinyl]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 164524533) has the molecular formula C25H31N7O3 and a molecular weight of 477.57 g/mol. Its IUPAC name is tert-butyl 4-[4-[6-amino-5-[(4-aminophenyl)carbamoyl]-3-pyridinyl]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[6-amino-5-[(4-aminophenyl)carbamoyl]-3-pyridinyl]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164524533 |
| Molecular Formula | C25H31N7O3 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | tert-butyl 4-[4-[6-amino-5-[(4-aminophenyl)carbamoyl]-3-pyridinyl]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(-c3cnc(N)c(C(=O)Nc4ccc(N)cc4)c3)cn2)CC1 |
| InChI | InChI=1S/C25H31N7O3/c1-25(2,3)35-24(34)31-10-8-20(9-11-31)32-15-17(14-29-32)16-12-21(22(27)28-13-16)23(33)30-19-6-4-18(26)5-7-19/h4-7,12-15,20H,8-11,26H2,1-3H3,(H2,27,28)(H,30,33) |
| InChIKey | KZRCMJZTZQNKBC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|