C24H36BN5O4 — CID 53487960
tert-butyl 4-[4-[6-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 53487960) has the molecular formula C24H36BN5O4 and a molecular weight of 469.40 g/mol. Its IUPAC name is tert-butyl 4-[4-[6-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[6-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 53487960 |
| Molecular Formula | C24H36BN5O4 |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | tert-butyl 4-[4-[6-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(-c3cnc(N)c(B4OC(C)(C)C(C)(C)O4)c3)cn2)CC1 |
| InChI | InChI=1S/C24H36BN5O4/c1-22(2,3)32-21(31)29-10-8-18(9-11-29)30-15-17(14-28-30)16-12-19(20(26)27-13-16)25-33-23(4,5)24(6,7)34-25/h12-15,18H,8-11H2,1-7H3,(H2,26,27) |
| InChIKey | STZXETLABQXDOR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|