C20H26F2N4O2 — CID 171921646
tert-butyl 4-[[4-(3-amino-2,6-difluorophenyl)pyrazol-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 171921646) has the molecular formula C20H26F2N4O2 and a molecular weight of 392.45 g/mol. Its IUPAC name is tert-butyl 4-[[4-(3-amino-2,6-difluorophenyl)pyrazol-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(3-amino-2,6-difluorophenyl)pyrazol-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171921646 |
| Molecular Formula | C20H26F2N4O2 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | tert-butyl 4-[[4-(3-amino-2,6-difluorophenyl)pyrazol-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cn2cc(-c3c(F)ccc(N)c3F)cn2)CC1 |
| InChI | InChI=1S/C20H26F2N4O2/c1-20(2,3)28-19(27)25-8-6-13(7-9-25)11-26-12-14(10-24-26)17-15(21)4-5-16(23)18(17)22/h4-5,10,12-13H,6-9,11,23H2,1-3H3 |
| InChIKey | SAPKDKNPMMUGMQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|