C13H14F2N4O — CID 171921652
2-[4-(3-amino-2,6-difluorophenyl)pyrazol-1-yl]-N,N-dimethylacetamide (PubChem CID 171921652) has the molecular formula C13H14F2N4O and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-[4-(3-amino-2,6-difluorophenyl)pyrazol-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-(3-amino-2,6-difluorophenyl)pyrazol-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 171921652 |
| Molecular Formula | C13H14F2N4O |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-[4-(3-amino-2,6-difluorophenyl)pyrazol-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cn1cc(-c2c(F)ccc(N)c2F)cn1 |
| InChI | InChI=1S/C13H14F2N4O/c1-18(2)11(20)7-19-6-8(5-17-19)12-9(14)3-4-10(16)13(12)15/h3-6H,7,16H2,1-2H3 |
| InChIKey | KAQMDKRZHAUVMO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|