C14H22FN3O2 — CID 139500307
tert-butyl 3-[(4-fluoropyrazol-1-yl)methyl]piperidine-1-carboxylate (PubChem CID 139500307) has the molecular formula C14H22FN3O2 and a molecular weight of 283.35 g/mol. Its IUPAC name is tert-butyl 3-[(4-fluoropyrazol-1-yl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(4-fluoropyrazol-1-yl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139500307 |
| Molecular Formula | C14H22FN3O2 |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | tert-butyl 3-[(4-fluoropyrazol-1-yl)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Cn2cc(F)cn2)C1 |
| InChI | InChI=1S/C14H22FN3O2/c1-14(2,3)20-13(19)17-6-4-5-11(8-17)9-18-10-12(15)7-16-18/h7,10-11H,4-6,8-9H2,1-3H3 |
| InChIKey | BYACLTFRTNBXLC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |