C21H26N4O3 — CID 166174676
tert-butyl 3-[[4-(2-cyanophenoxy)pyrazol-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 166174676) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is tert-butyl 3-[[4-(2-cyanophenoxy)pyrazol-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-(2-cyanophenoxy)pyrazol-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166174676 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | tert-butyl 3-[[4-(2-cyanophenoxy)pyrazol-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Cn2cc(Oc3ccccc3C#N)cn2)C1 |
| InChI | InChI=1S/C21H26N4O3/c1-21(2,3)28-20(26)24-10-6-7-16(13-24)14-25-15-18(12-23-25)27-19-9-5-4-8-17(19)11-22/h4-5,8-9,12,15-16H,6-7,10,13-14H2,1-3H3 |
| InChIKey | PSPRPORICOGZMX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 80.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |