C16H27N3O2 — CID 101211732
tert-butyl 3-[(5-methylimidazol-1-yl)methyl]azepane-1-carboxylate (PubChem CID 101211732) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is tert-butyl 3-[(5-methylimidazol-1-yl)methyl]azepane-1-carboxylate.
| Compound Name | tert-butyl 3-[(5-methylimidazol-1-yl)methyl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 101211732 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | tert-butyl 3-[(5-methylimidazol-1-yl)methyl]azepane-1-carboxylate |
| SMILES | Cc1cncn1CC1CCCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H27N3O2/c1-13-9-17-12-19(13)11-14-7-5-6-8-18(10-14)15(20)21-16(2,3)4/h9,12,14H,5-8,10-11H2,1-4H3 |
| InChIKey | FVYLRHPDGCWEEE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |