C20H29NO3 — CID 135078914
tert-butyl 4-(2-oxoethyl)piperidine-1-carboxylate;styrene (PubChem CID 135078914) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is tert-butyl 4-(2-oxoethyl)piperidine-1-carboxylate;styrene.
| Compound Name | tert-butyl 4-(2-oxoethyl)piperidine-1-carboxylate;styrene |
|---|---|
| PubChem CID | 135078914 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | tert-butyl 4-(2-oxoethyl)piperidine-1-carboxylate;styrene |
| SMILES | C=Cc1ccccc1.CC(C)(C)OC(=O)N1CCC(CC=O)CC1 |
| InChI | InChI=1S/C12H21NO3.C8H8/c1-12(2,3)16-11(15)13-7-4-10(5-8-13)6-9-14;1-2-8-6-4-3-5-7-8/h9-10H,4-8H2,1-3H3;2-7H,1H2 |
| InChIKey | OHHMRCWJWGOXCB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|