C19H26FNO2 — CID 76625784
tert-butyl 4-[3-(4-fluorophenyl)prop-2-enyl]piperidine-1-carboxylate (PubChem CID 76625784) has the molecular formula C19H26FNO2 and a molecular weight of 319.42 g/mol. Its IUPAC name is tert-butyl 4-[3-(4-fluorophenyl)prop-2-enyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(4-fluorophenyl)prop-2-enyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 76625784 |
| Molecular Formula | C19H26FNO2 |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | tert-butyl 4-[3-(4-fluorophenyl)prop-2-enyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC=Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H26FNO2/c1-19(2,3)23-18(22)21-13-11-16(12-14-21)6-4-5-15-7-9-17(20)10-8-15/h4-5,7-10,16H,6,11-14H2,1-3H3 |
| InChIKey | JMTPCUNLWACHBY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |