C20H26N2O2 — CID 68715497
tert-butyl 4-[(Z)-3-(4-cyanophenyl)prop-2-enyl]piperidine-1-carboxylate (PubChem CID 68715497) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is tert-butyl 4-[(Z)-3-(4-cyanophenyl)prop-2-enyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(Z)-3-(4-cyanophenyl)prop-2-enyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68715497 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | tert-butyl 4-[(Z)-3-(4-cyanophenyl)prop-2-enyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C/C=C\c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C20H26N2O2/c1-20(2,3)24-19(23)22-13-11-17(12-14-22)6-4-5-16-7-9-18(15-21)10-8-16/h4-5,7-10,17H,6,11-14H2,1-3H3/b5-4- |
| InChIKey | NIPVBSVWHNIVMZ-PLNGDYQASA-N |
| XLogP | 4.61 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |