C22H32N4O2 — CID 15947412
tert-butyl 4-[[4-(3-cyanophenyl)piperazin-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 15947412) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is tert-butyl 4-[[4-(3-cyanophenyl)piperazin-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(3-cyanophenyl)piperazin-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 15947412 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | tert-butyl 4-[[4-(3-cyanophenyl)piperazin-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CN2CCN(c3cccc(C#N)c3)CC2)CC1 |
| InChI | InChI=1S/C22H32N4O2/c1-22(2,3)28-21(27)26-9-7-18(8-10-26)17-24-11-13-25(14-12-24)20-6-4-5-19(15-20)16-23/h4-6,15,18H,7-14,17H2,1-3H3 |
| InChIKey | QWNJQATWMAFEJI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 59.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |