C21H32N4O5 — CID 172591174
tert-butyl 4-[[1-(3-hydroxy-4-nitrophenyl)piperidin-4-yl]methyl]piperazine-1-carboxylate (PubChem CID 172591174) has the molecular formula C21H32N4O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is tert-butyl 4-[[1-(3-hydroxy-4-nitrophenyl)piperidin-4-yl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-(3-hydroxy-4-nitrophenyl)piperidin-4-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 172591174 |
| Molecular Formula | C21H32N4O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | tert-butyl 4-[[1-(3-hydroxy-4-nitrophenyl)piperidin-4-yl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC2CCN(c3ccc([N+](=O)[O-])c(O)c3)CC2)CC1 |
| InChI | InChI=1S/C21H32N4O5/c1-21(2,3)30-20(27)24-12-10-22(11-13-24)15-16-6-8-23(9-7-16)17-4-5-18(25(28)29)19(26)14-17/h4-5,14,16,26H,6-13,15H2,1-3H3 |
| InChIKey | BWZJQGYQHUKSGV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 99.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|