C17H24N4O5 — CID 166571535
tert-butyl 4-(3-acetamido-4-nitrophenyl)piperazine-1-carboxylate (PubChem CID 166571535) has the molecular formula C17H24N4O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is tert-butyl 4-(3-acetamido-4-nitrophenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-acetamido-4-nitrophenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166571535 |
| Molecular Formula | C17H24N4O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | tert-butyl 4-(3-acetamido-4-nitrophenyl)piperazine-1-carboxylate |
| SMILES | CC(=O)Nc1cc(N2CCN(C(=O)OC(C)(C)C)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H24N4O5/c1-12(22)18-14-11-13(5-6-15(14)21(24)25)19-7-9-20(10-8-19)16(23)26-17(2,3)4/h5-6,11H,7-10H2,1-4H3,(H,18,22) |
| InChIKey | MOMAAIYCTWHBAB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|