C28H28N4O6 — CID 158877558
tert-butyl 4-[3-[2-(1H-indol-3-yl)-3,5-dioxocyclopenten-1-yl]-4-nitrophenyl]piperazine-1-carboxylate (PubChem CID 158877558) has the molecular formula C28H28N4O6 and a molecular weight of 516.55 g/mol. Its IUPAC name is tert-butyl 4-[3-[2-(1H-indol-3-yl)-3,5-dioxocyclopenten-1-yl]-4-nitrophenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[2-(1H-indol-3-yl)-3,5-dioxocyclopenten-1-yl]-4-nitrophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 158877558 |
| Molecular Formula | C28H28N4O6 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | tert-butyl 4-[3-[2-(1H-indol-3-yl)-3,5-dioxocyclopenten-1-yl]-4-nitrophenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc([N+](=O)[O-])c(C3=C(c4c[nH]c5ccccc45)C(=O)CC3=O)c2)CC1 |
| InChI | InChI=1S/C28H28N4O6/c1-28(2,3)38-27(35)31-12-10-30(11-13-31)17-8-9-22(32(36)37)19(14-17)25-23(33)15-24(34)26(25)20-16-29-21-7-5-4-6-18(20)21/h4-9,14,16,29H,10-13,15H2,1-3H3 |
| InChIKey | JCPWYRYQVCLPNF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 125.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|