C19H30N4O4 — CID 154638087
tert-butyl 4-[3-(butylamino)-4-nitrophenyl]piperazine-1-carboxylate (PubChem CID 154638087) has the molecular formula C19H30N4O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is tert-butyl 4-[3-(butylamino)-4-nitrophenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(butylamino)-4-nitrophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 154638087 |
| Molecular Formula | C19H30N4O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | tert-butyl 4-[3-(butylamino)-4-nitrophenyl]piperazine-1-carboxylate |
| SMILES | CCCCNc1cc(N2CCN(C(=O)OC(C)(C)C)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H30N4O4/c1-5-6-9-20-16-14-15(7-8-17(16)23(25)26)21-10-12-22(13-11-21)18(24)27-19(2,3)4/h7-8,14,20H,5-6,9-13H2,1-4H3 |
| InChIKey | VCYBWBSDOAQNGZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|