C26H42N4O5 — CID 176823957
tert-butyl 9-[3-[[(2R)-5-hydroxy-2-methylpentyl]amino]-4-nitrophenyl]-3,9-diazaspiro[5.5]undecane-3-carboxylate (PubChem CID 176823957) has the molecular formula C26H42N4O5 and a molecular weight of 490.65 g/mol. Its IUPAC name is tert-butyl 9-[3-[[(2R)-5-hydroxy-2-methylpentyl]amino]-4-nitrophenyl]-3,9-diazaspiro[5.5]undecane-3-carboxylate.
| Compound Name | tert-butyl 9-[3-[[(2R)-5-hydroxy-2-methylpentyl]amino]-4-nitrophenyl]-3,9-diazaspiro[5.5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 176823957 |
| Molecular Formula | C26H42N4O5 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | tert-butyl 9-[3-[[(2R)-5-hydroxy-2-methylpentyl]amino]-4-nitrophenyl]-3,9-diazaspiro[5.5]undecane-3-carboxylate |
| SMILES | C[C@H](CCCO)CNc1cc(N2CCC3(CCN(C(=O)OC(C)(C)C)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H42N4O5/c1-20(6-5-17-31)19-27-22-18-21(7-8-23(22)30(33)34)28-13-9-26(10-14-28)11-15-29(16-12-26)24(32)35-25(2,3)4/h7-8,18,20,27,31H,5-6,9-17,19H2,1-4H3/t20-/m1/s1 |
| InChIKey | JZYDNBXLNGYHJS-HXUWFJFHSA-N |
| XLogP | 5.03 |
| TPSA | 108.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|