C15H28N2O5 — CID 176653567
tert-butyl 4-(3-hydroxypropyl)-4-(1-nitroethyl)piperidine-1-carboxylate (PubChem CID 176653567) has the molecular formula C15H28N2O5 and a molecular weight of 316.40 g/mol. Its IUPAC name is tert-butyl 4-(3-hydroxypropyl)-4-(1-nitroethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-hydroxypropyl)-4-(1-nitroethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 176653567 |
| Molecular Formula | C15H28N2O5 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | tert-butyl 4-(3-hydroxypropyl)-4-(1-nitroethyl)piperidine-1-carboxylate |
| SMILES | CC([N+](=O)[O-])C1(CCCO)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H28N2O5/c1-12(17(20)21)15(6-5-11-18)7-9-16(10-8-15)13(19)22-14(2,3)4/h12,18H,5-11H2,1-4H3 |
| InChIKey | QGDNJGOBRVNZGL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|