C15H28N2O7S — CID 156709813
tert-butyl 4-(2-methylsulfonyloxyethyl)-4-(1-nitroethyl)piperidine-1-carboxylate (PubChem CID 156709813) has the molecular formula C15H28N2O7S and a molecular weight of 380.46 g/mol. Its IUPAC name is tert-butyl 4-(2-methylsulfonyloxyethyl)-4-(1-nitroethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-methylsulfonyloxyethyl)-4-(1-nitroethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 156709813 |
| Molecular Formula | C15H28N2O7S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | tert-butyl 4-(2-methylsulfonyloxyethyl)-4-(1-nitroethyl)piperidine-1-carboxylate |
| SMILES | CC([N+](=O)[O-])C1(CCOS(C)(=O)=O)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H28N2O7S/c1-12(17(19)20)15(8-11-23-25(5,21)22)6-9-16(10-7-15)13(18)24-14(2,3)4/h12H,6-11H2,1-5H3 |
| InChIKey | OMBBENUCMGYWFM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|