C14H28ClNO7S2 — CID 175544616
tert-butyl 4-(2-methylsulfonyloxyethyl)piperidine-1-carboxylate;methanesulfonyl chloride (PubChem CID 175544616) has the molecular formula C14H28ClNO7S2 and a molecular weight of 421.97 g/mol. Its IUPAC name is tert-butyl 4-(2-methylsulfonyloxyethyl)piperidine-1-carboxylate;methanesulfonyl chloride.
| Compound Name | tert-butyl 4-(2-methylsulfonyloxyethyl)piperidine-1-carboxylate;methanesulfonyl chloride |
|---|---|
| PubChem CID | 175544616 |
| Molecular Formula | C14H28ClNO7S2 |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | tert-butyl 4-(2-methylsulfonyloxyethyl)piperidine-1-carboxylate;methanesulfonyl chloride |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCOS(C)(=O)=O)CC1.CS(=O)(=O)Cl |
| InChI | InChI=1S/C13H25NO5S.CH3ClO2S/c1-13(2,3)19-12(15)14-8-5-11(6-9-14)7-10-18-20(4,16)17;1-5(2,3)4/h11H,5-10H2,1-4H3;1H3 |
| InChIKey | DZHWPTXWFOYRKR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|