C17H32N2O6S — CID 140841497
tert-butyl 4-(5-methylsulfonyloxypentylcarbamoyl)piperidine-1-carboxylate (PubChem CID 140841497) has the molecular formula C17H32N2O6S and a molecular weight of 392.52 g/mol. Its IUPAC name is tert-butyl 4-(5-methylsulfonyloxypentylcarbamoyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-methylsulfonyloxypentylcarbamoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140841497 |
| Molecular Formula | C17H32N2O6S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | tert-butyl 4-(5-methylsulfonyloxypentylcarbamoyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)NCCCCCOS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C17H32N2O6S/c1-17(2,3)25-16(21)19-11-8-14(9-12-19)15(20)18-10-6-5-7-13-24-26(4,22)23/h14H,5-13H2,1-4H3,(H,18,20) |
| InChIKey | XQUQAYFDZRTPBU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|