C21H39IN2O7S — CID 159717995
tert-butyl 4-iodopiperidine-1-carboxylate;tert-butyl 4-methylsulfonyloxypiperidine-1-carboxylate (PubChem CID 159717995) has the molecular formula C21H39IN2O7S and a molecular weight of 590.52 g/mol. Its IUPAC name is tert-butyl 4-iodopiperidine-1-carboxylate;tert-butyl 4-methylsulfonyloxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-iodopiperidine-1-carboxylate;tert-butyl 4-methylsulfonyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 159717995 |
| Molecular Formula | C21H39IN2O7S |
| Molecular Weight | 590.52 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | tert-butyl 4-iodopiperidine-1-carboxylate;tert-butyl 4-methylsulfonyloxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(I)CC1.CC(C)(C)OC(=O)N1CCC(OS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C11H21NO5S.C10H18INO2/c1-11(2,3)16-10(13)12-7-5-9(6-8-12)17-18(4,14)15;1-10(2,3)14-9(13)12-6-4-8(11)5-7-12/h9H,5-8H2,1-4H3;8H,4-7H2,1-3H3 |
| InChIKey | MZRDBQNOXKOWIY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|