C12H20F3NO5S — CID 138697173
tert-butyl (2R,4S)-4-methylsulfonyloxy-2-(trifluoromethyl)piperidine-1-carboxylate (PubChem CID 138697173) has the molecular formula C12H20F3NO5S and a molecular weight of 347.36 g/mol. Its IUPAC name is tert-butyl (2R,4S)-4-methylsulfonyloxy-2-(trifluoromethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-4-methylsulfonyloxy-2-(trifluoromethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 138697173 |
| Molecular Formula | C12H20F3NO5S |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | tert-butyl (2R,4S)-4-methylsulfonyloxy-2-(trifluoromethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](OS(C)(=O)=O)C[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C12H20F3NO5S/c1-11(2,3)20-10(17)16-6-5-8(21-22(4,18)19)7-9(16)12(13,14)15/h8-9H,5-7H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | PVCYDNCQOFJYAP-DTWKUNHWSA-N |
| XLogP | 2.29 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|