C17H24FNO5S — CID 87564416
tert-butyl 2-(4-fluorophenyl)-4-methylsulfonyloxypiperidine-1-carboxylate (PubChem CID 87564416) has the molecular formula C17H24FNO5S and a molecular weight of 373.45 g/mol. Its IUPAC name is tert-butyl 2-(4-fluorophenyl)-4-methylsulfonyloxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(4-fluorophenyl)-4-methylsulfonyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 87564416 |
| Molecular Formula | C17H24FNO5S |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | tert-butyl 2-(4-fluorophenyl)-4-methylsulfonyloxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OS(C)(=O)=O)CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H24FNO5S/c1-17(2,3)23-16(20)19-10-9-14(24-25(4,21)22)11-15(19)12-5-7-13(18)8-6-12/h5-8,14-15H,9-11H2,1-4H3 |
| InChIKey | UJLDUNWAIJTLQX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|