C25H42FNO3Si — CID 53242249
tert-butyl (2S,4R)-2-(4-fluorophenyl)-4-tri(propan-2-yl)silyloxypiperidine-1-carboxylate (PubChem CID 53242249) has the molecular formula C25H42FNO3Si and a molecular weight of 451.70 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-(4-fluorophenyl)-4-tri(propan-2-yl)silyloxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-(4-fluorophenyl)-4-tri(propan-2-yl)silyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 53242249 |
| Molecular Formula | C25H42FNO3Si |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | tert-butyl (2S,4R)-2-(4-fluorophenyl)-4-tri(propan-2-yl)silyloxypiperidine-1-carboxylate |
| SMILES | CC(C)[Si](O[C@@H]1CCN(C(=O)OC(C)(C)C)[C@H](c2ccc(F)cc2)C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H42FNO3Si/c1-17(2)31(18(3)4,19(5)6)30-22-14-15-27(24(28)29-25(7,8)9)23(16-22)20-10-12-21(26)13-11-20/h10-13,17-19,22-23H,14-16H2,1-9H3/t22-,23+/m1/s1 |
| InChIKey | WDHXOKPYHGEXRW-PKTZIBPZSA-N |
| XLogP | 7.46 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|