C25H34FNO3Si — CID 11236115
benzyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-fluorophenyl)piperidine-1-carboxylate (PubChem CID 11236115) has the molecular formula C25H34FNO3Si and a molecular weight of 443.64 g/mol. Its IUPAC name is benzyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-fluorophenyl)piperidine-1-carboxylate.
| Compound Name | benzyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-fluorophenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11236115 |
| Molecular Formula | C25H34FNO3Si |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | benzyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-fluorophenyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCCN(C(=O)OCc2ccccc2)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H34FNO3Si/c1-25(2,3)31(4,5)30-22-12-9-17-27(23(22)20-13-15-21(26)16-14-20)24(28)29-18-19-10-7-6-8-11-19/h6-8,10-11,13-16,22-23H,9,12,17-18H2,1-5H3/t22-,23-/m1/s1 |
| InChIKey | BQVIFWHLGISCMY-DHIUTWEWSA-N |
| XLogP | 6.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|