C10H16F3NO3 — CID 154523095
tert-butyl 4-hydroxy-2-(trifluoromethyl)pyrrolidine-1-carboxylate (PubChem CID 154523095) has the molecular formula C10H16F3NO3 and a molecular weight of 255.24 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-2-(trifluoromethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-2-(trifluoromethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 154523095 |
| Molecular Formula | C10H16F3NO3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | tert-butyl 4-hydroxy-2-(trifluoromethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O)CC1C(F)(F)F |
| InChI | InChI=1S/C10H16F3NO3/c1-9(2,3)17-8(16)14-5-6(15)4-7(14)10(11,12)13/h6-7,15H,4-5H2,1-3H3 |
| InChIKey | LHHCPBHFTMOFJS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |