C11H19NO5 — CID 159053694
tert-butyl (4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate;carbon dioxide (PubChem CID 159053694) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is tert-butyl (4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate;carbon dioxide.
| Compound Name | tert-butyl (4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate;carbon dioxide |
|---|---|
| PubChem CID | 159053694 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | tert-butyl (4R)-4-hydroxy-2-methylpyrrolidine-1-carboxylate;carbon dioxide |
| SMILES | CC1C[C@@H](O)CN1C(=O)OC(C)(C)C.O=C=O |
| InChI | InChI=1S/C10H19NO3.CO2/c1-7-5-8(12)6-11(7)9(13)14-10(2,3)4;2-1-3/h7-8,12H,5-6H2,1-4H3;/t7?,8-;/m1./s1 |
| InChIKey | JXPBPOQXQHSAFE-LTTWWRRRSA-N |
| XLogP | 0.79 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |