C10H18FNO2 — CID 118296593
tert-butyl (2S)-4-fluoro-2-methylpyrrolidine-1-carboxylate (PubChem CID 118296593) has the molecular formula C10H18FNO2 and a molecular weight of 203.26 g/mol. Its IUPAC name is tert-butyl (2S)-4-fluoro-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-fluoro-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118296593 |
| Molecular Formula | C10H18FNO2 |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | tert-butyl (2S)-4-fluoro-2-methylpyrrolidine-1-carboxylate |
| SMILES | C[C@H]1CC(F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H18FNO2/c1-7-5-8(11)6-12(7)9(13)14-10(2,3)4/h7-8H,5-6H2,1-4H3/t7-,8?/m0/s1 |
| InChIKey | VEEUIJVNQJDUKD-JAMMHHFISA-N |
| XLogP | 2.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |