C10H16FNO3 — CID 154003917
tert-butyl (4S)-4-fluoro-2-formylpyrrolidine-1-carboxylate (PubChem CID 154003917) has the molecular formula C10H16FNO3 and a molecular weight of 217.24 g/mol. Its IUPAC name is tert-butyl (4S)-4-fluoro-2-formylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-4-fluoro-2-formylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 154003917 |
| Molecular Formula | C10H16FNO3 |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | tert-butyl (4S)-4-fluoro-2-formylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](F)CC1C=O |
| InChI | InChI=1S/C10H16FNO3/c1-10(2,3)15-9(14)12-5-7(11)4-8(12)6-13/h6-8H,4-5H2,1-3H3/t7-,8?/m0/s1 |
| InChIKey | PABLOPMZCFQFHB-JAMMHHFISA-N |
| XLogP | 1.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|