C11H19NO4 — CID 124652560
tert-butyl (2R,4S)-2-formyl-4-methoxypyrrolidine-1-carboxylate (PubChem CID 124652560) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is tert-butyl (2R,4S)-2-formyl-4-methoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-2-formyl-4-methoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 124652560 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | tert-butyl (2R,4S)-2-formyl-4-methoxypyrrolidine-1-carboxylate |
| SMILES | CO[C@H]1C[C@H](C=O)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C11H19NO4/c1-11(2,3)16-10(14)12-6-9(15-4)5-8(12)7-13/h7-9H,5-6H2,1-4H3/t8-,9+/m1/s1 |
| InChIKey | XAIXKICCDVTSDD-BDAKNGLRSA-N |
| XLogP | 1.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|