C11H21NO5 — CID 174342667
tert-butyl (2S,4R)-2-(dihydroxymethyl)-4-methoxypyrrolidine-1-carboxylate (PubChem CID 174342667) has the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-(dihydroxymethyl)-4-methoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-(dihydroxymethyl)-4-methoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 174342667 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | tert-butyl (2S,4R)-2-(dihydroxymethyl)-4-methoxypyrrolidine-1-carboxylate |
| SMILES | CO[C@@H]1C[C@@H](C(O)O)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C11H21NO5/c1-11(2,3)17-10(15)12-6-7(16-4)5-8(12)9(13)14/h7-9,13-14H,5-6H2,1-4H3/t7-,8+/m1/s1 |
| InChIKey | RMXHCQBECHVUBU-SFYZADRCSA-N |
| XLogP | 0.32 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|