C11H20N2O4 — CID 58984915
tert-butyl (2S,4S)-2-[(E)-hydroxyiminomethyl]-4-methoxypyrrolidine-1-carboxylate (PubChem CID 58984915) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-[(E)-hydroxyiminomethyl]-4-methoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-[(E)-hydroxyiminomethyl]-4-methoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58984915 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | tert-butyl (2S,4S)-2-[(E)-hydroxyiminomethyl]-4-methoxypyrrolidine-1-carboxylate |
| SMILES | CO[C@H]1C[C@@H](/C=N/O)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C11H20N2O4/c1-11(2,3)17-10(14)13-7-9(16-4)5-8(13)6-12-15/h6,8-9,15H,5,7H2,1-4H3/b12-6+/t8-,9-/m0/s1 |
| InChIKey | LCYRVANQEPZYTI-WSAQVDGISA-N |
| XLogP | 1.47 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|