C14H27NO5 — CID 70229386
tert-butyl (2S,4R)-2-(ethoxymethoxymethyl)-4-methoxypyrrolidine-1-carboxylate (PubChem CID 70229386) has the molecular formula C14H27NO5 and a molecular weight of 289.37 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-(ethoxymethoxymethyl)-4-methoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-(ethoxymethoxymethyl)-4-methoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70229386 |
| Molecular Formula | C14H27NO5 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | tert-butyl (2S,4R)-2-(ethoxymethoxymethyl)-4-methoxypyrrolidine-1-carboxylate |
| SMILES | CCOCOC[C@@H]1C[C@@H](OC)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27NO5/c1-6-18-10-19-9-11-7-12(17-5)8-15(11)13(16)20-14(2,3)4/h11-12H,6-10H2,1-5H3/t11-,12+/m0/s1 |
| InChIKey | USVAWSISRHANRS-NWDGAFQWSA-N |
| XLogP | 2.02 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|