C12H23NO5S — CID 67033711
tert-butyl 2-(methoxymethyl)-4-methylsulfinyloxypyrrolidine-1-carboxylate (PubChem CID 67033711) has the molecular formula C12H23NO5S and a molecular weight of 293.38 g/mol. Its IUPAC name is tert-butyl 2-(methoxymethyl)-4-methylsulfinyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(methoxymethyl)-4-methylsulfinyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67033711 |
| Molecular Formula | C12H23NO5S |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | tert-butyl 2-(methoxymethyl)-4-methylsulfinyloxypyrrolidine-1-carboxylate |
| SMILES | COCC1CC(OS(C)=O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23NO5S/c1-12(2,3)17-11(14)13-7-10(18-19(5)15)6-9(13)8-16-4/h9-10H,6-8H2,1-5H3 |
| InChIKey | PBDKYNOHQJZPLJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |