C13H25NO4 — CID 172691809
tert-butyl 4-(hydroxymethyl)-2-(methoxymethyl)piperidine-1-carboxylate (PubChem CID 172691809) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is tert-butyl 4-(hydroxymethyl)-2-(methoxymethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(hydroxymethyl)-2-(methoxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172691809 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | tert-butyl 4-(hydroxymethyl)-2-(methoxymethyl)piperidine-1-carboxylate |
| SMILES | COCC1CC(CO)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25NO4/c1-13(2,3)18-12(16)14-6-5-10(8-15)7-11(14)9-17-4/h10-11,15H,5-9H2,1-4H3 |
| InChIKey | BTXHTSOYJLWMKK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |