C9H17NO3 — CID 11074142
tert-butyl (2R)-2-(hydroxymethyl)azetidine-1-carboxylate (PubChem CID 11074142) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is tert-butyl (2R)-2-(hydroxymethyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-(hydroxymethyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 11074142 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | tert-butyl (2R)-2-(hydroxymethyl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]1CO |
| InChI | InChI=1S/C9H17NO3/c1-9(2,3)13-8(12)10-5-4-7(10)6-11/h7,11H,4-6H2,1-3H3/t7-/m1/s1 |
| InChIKey | XIRUXUKRGUFEKC-SSDOTTSWSA-N |
| XLogP | 0.99 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |